CAS 952474-39-4 is the registry number for PARP1-IN-37. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-phenylindazole-7-carboxamide (CAS 952474-39-4) is a chemical compound with the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. IUPAC name: 2-phenylindazole-7-carboxamide. InChIKey: MWXFYWRQDSMARJ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O |
|---|---|
| Molecular weight | 237.26 g/mol |
| IUPAC name | 2-phenylindazole-7-carboxamide |
| InChIKey | MWXFYWRQDSMARJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C3C=CC=C(C3=N2)C(=O)N |
Computed by PubChem (NCBI)