CAS 95282-00-1 is the registry number for Menitazene, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 5mg.
N,N-diethyl-2-[2-[(4-methylphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethanamine (CAS 95282-00-1) is a chemical compound with the molecular formula C21H26N4O2 and a molecular weight of 366.5 g/mol. IUPAC name: N,N-diethyl-2-[2-[(4-methylphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethanamine. InChIKey: XGHTZJUKJYZDSW-UHFFFAOYSA-N.
| Molecular formula | C21H26N4O2 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | N,N-diethyl-2-[2-[(4-methylphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethanamine |
| InChIKey | XGHTZJUKJYZDSW-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)