Products 248919-64-4
CAS 248919-64-4 appears in our catalog under these names: Linaprazan/ 99.63% (existing batch purity), Linaprazan (AZD0865), AZD0865, Linaprazan, 98.80%, Linaprazan (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso), 10 mg.
8-[(2,6-dimethylphenyl)methylamino]-N-(2-hydroxyethyl)-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide (CAS 248919-64-4) is a chemical compound with the molecular formula C21H26N4O2 and a molecular weight of 366.5 g/mol. IUPAC name: 8-[(2,6-dimethylphenyl)methylamino]-N-(2-hydroxyethyl)-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide. InChIKey: GHVIMBCFLRTFHI-UHFFFAOYSA-N.
| Molecular formula | C21H26N4O2 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 8-[(2,6-dimethylphenyl)methylamino]-N-(2-hydroxyethyl)-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide |
| InChIKey | GHVIMBCFLRTFHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CNC2=CC(=CN3C2=NC(=C3C)C)C(=O)NCCO |
Computed by PubChem (NCBI)