CAS 952900-60-6 appears in our catalog under these names: 4-[Ethyl(methylsulfonyl)amino]benzoic acid, 98%, 4-(EThyl(methylsulfonyl)amino)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
4-[ethyl(methylsulfonyl)amino]benzoic acid (CAS 952900-60-6) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 4-[ethyl(methylsulfonyl)amino]benzoic acid. InChIKey: NRXSHAKGAWIHFH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 4-[ethyl(methylsulfonyl)amino]benzoic acid |
| InChIKey | NRXSHAKGAWIHFH-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)