Products 953039-13-9
CAS 953039-13-9 is the registry number for 6-Bromo-8-methoxyquinazolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-8-methoxy-1H-quinazolin-2-one (CAS 953039-13-9) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-8-methoxy-1H-quinazolin-2-one. InChIKey: HVFYLIKECNEGDI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-8-methoxy-1H-quinazolin-2-one |
| InChIKey | HVFYLIKECNEGDI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1NC(=O)N=C2)Br |
Computed by PubChem (NCBI)