Products 953731-93-6
CAS 953731-93-6 appears in our catalog under these names: 6-(3-Bromophenoxy)-3-pyridinecarboxylic acid, 6-(3-Bromophenoxy)nicotinic acid, 95%, 6-(3-Bromophenoxy)-3-pyridinecarboxylic acid 95%, 6-(3-Bromophenoxy)-3-pyridinecarboxylic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 0,5g, 1g, 50mg, 100mg, 250mg.
6-(3-bromophenoxy)pyridine-3-carboxylic acid (CAS 953731-93-6) is a chemical compound with the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. IUPAC name: 6-(3-bromophenoxy)pyridine-3-carboxylic acid. InChIKey: ZPYHFZDCAZOSBO-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO3 |
|---|---|
| Molecular weight | 294.10 g/mol |
| IUPAC name | 6-(3-bromophenoxy)pyridine-3-carboxylic acid |
| InChIKey | ZPYHFZDCAZOSBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)