Products 953735-83-6
CAS 953735-83-6 is the registry number for 1-((4-Aminophenyl)methyl)piperidine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[(4-aminophenyl)methyl]piperidine-3-carboxamide (CAS 953735-83-6) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]piperidine-3-carboxamide. InChIKey: LTKSBKLJMOYVAC-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]piperidine-3-carboxamide |
| InChIKey | LTKSBKLJMOYVAC-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=C(C=C2)N)C(=O)N |
Computed by PubChem (NCBI)