Products 95420-78-3

CAS 95420-78-3 is the registry number for 4-(Dimethylamino)-2-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(dimethylamino)-2-methoxybenzoic acid (CAS 95420-78-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 4-(dimethylamino)-2-methoxybenzoic acid. InChIKey: IKQMYHQYUPTFKW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC name4-(dimethylamino)-2-methoxybenzoic acid
InChIKeyIKQMYHQYUPTFKW-UHFFFAOYSA-N
SMILESCN(C)C1=CC(=C(C=C1)C(=O)O)OC

Computed by PubChem (NCBI)