Products 954269-88-6
CAS 954269-88-6 is the registry number for {2-amino-2-(3-(trifluoromethyl)phenyl)ethyl}dimethylamine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N',N'-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (CAS 954269-88-6) is a chemical compound with the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. IUPAC name: N',N'-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine. InChIKey: FXOGIUBNPMYFMF-UHFFFAOYSA-N.
| Molecular formula | C11H15F3N2 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | N',N'-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| InChIKey | FXOGIUBNPMYFMF-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC(=CC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)