CAS 96788-00-0 appears in our catalog under these names: (2-Amino-1-[3-(trifluoromethyl)phenyl]ethyl)dimethylamine, 95%, N1,N1-Dimethyl-1-(3-(trifluoromethyl)phenyl)ethane-1,2-diamine, 95+%, N*1*,N*1*-Dimethyl-1-(3-trifluoromethyl-phenyl)-ethane-1,2-diamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g.
N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (CAS 96788-00-0) is a chemical compound with the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. IUPAC name: N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine. InChIKey: WSFINPCMQGMMKB-UHFFFAOYSA-N.
| Molecular formula | C11H15F3N2 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| InChIKey | WSFINPCMQGMMKB-UHFFFAOYSA-N |
| SMILES | CN(C)C(CN)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)