Products 954277-71-5

CAS 954277-71-5 is the registry number for 5-Chloro-6-ethoxypyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-chloro-6-ethoxypyridine-3-carboxylic acid (CAS 954277-71-5) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-6-ethoxypyridine-3-carboxylic acid. InChIKey: KFJJKOQGQVNZEN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO3
Molecular weight201.61 g/mol
IUPAC name5-chloro-6-ethoxypyridine-3-carboxylic acid
InChIKeyKFJJKOQGQVNZEN-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=N1)C(=O)O)Cl

Computed by PubChem (NCBI)