Products 954584-13-5

CAS 954584-13-5 is the registry number for 3-(1H-Imidazol-5-yl)-2-(1h-pyrrol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(1H-imidazol-5-yl)-2-pyrrol-1-ylpropanoic acid (CAS 954584-13-5) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 3-(1H-imidazol-5-yl)-2-pyrrol-1-ylpropanoic acid. InChIKey: XTGWWGRMXKSWQM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3O2
Molecular weight205.21 g/mol
IUPAC name3-(1H-imidazol-5-yl)-2-pyrrol-1-ylpropanoic acid
InChIKeyXTGWWGRMXKSWQM-UHFFFAOYSA-N
SMILESC1=CN(C=C1)C(CC2=CN=CN2)C(=O)O

Computed by PubChem (NCBI)