CAS 95462-09-2 is the registry number for (-)-(2S,3S)-Viridifloric Acid Acetonide-d7. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4S,5S)-2,2,5-trimethyl-4-propan-2-yl-1,3-dioxolane-4-carboxylic acid (CAS 95462-09-2) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: (4S,5S)-2,2,5-trimethyl-4-propan-2-yl-1,3-dioxolane-4-carboxylic acid. InChIKey: UAKFCKACZPDGQM-XVKPBYJWSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (4S,5S)-2,2,5-trimethyl-4-propan-2-yl-1,3-dioxolane-4-carboxylic acid |
| InChIKey | UAKFCKACZPDGQM-XVKPBYJWSA-N |
| SMILES | C[C@H]1[C@@](OC(O1)(C)C)(C(C)C)C(=O)O |
Computed by PubChem (NCBI)