Products 95497-55-5
CAS 95497-55-5 appears in our catalog under these names: 9(Z),11(E),13(Z)–Octadecatrienoic Acid methyl ester, 9Z,11E,13Z-Octadecatrienoic Acid Methyl Ester, 9(Z)，11(E)，13(Z)-Octadecatrienoic Acid methyl ester, 9Z,11E,13Z-Octadecatrienoicacid, methylester. Offered by: GLPBio, TRC, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 10 mg, 5 mg.
Methyl (9Z,11E,13Z)-octadeca-9,11,13-trienoate (CAS 95497-55-5) is a chemical compound with the molecular formula C19H32O2 and a molecular weight of 292.5 g/mol. IUPAC name: methyl (9Z,11E,13Z)-octadeca-9,11,13-trienoate. InChIKey: KOJYENXGDXRGDK-KDQYYBQISA-N.
| Molecular formula | C19H32O2 |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | methyl (9Z,11E,13Z)-octadeca-9,11,13-trienoate |
| InChIKey | KOJYENXGDXRGDK-KDQYYBQISA-N |
| SMILES | CCCC/C=C\C=C\C=C/CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)