Products 95522-45-5

CAS 95522-45-5 is the registry number for Colestilan. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 100mg, 25mg, 50mg, 2g, 50 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-(chloromethyl)oxirane;2-methyl-1H-imidazole (CAS 95522-45-5) is a chemical compound with the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. IUPAC name: 2-(chloromethyl)oxirane;2-methyl-1H-imidazole. InChIKey: DEMLYXMVPJAVFU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O
Molecular weight174.63 g/mol
IUPAC name2-(chloromethyl)oxirane;2-methyl-1H-imidazole
InChIKeyDEMLYXMVPJAVFU-UHFFFAOYSA-N
SMILESCC1=NC=CN1.C1C(O1)CCl

Computed by PubChem (NCBI)