Products 955314-80-4

CAS 955314-80-4 is the registry number for 3-tert-Butoxycarbonylamino-5-phenyl-pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid (CAS 955314-80-4) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid. InChIKey: MYWZFJXOLAXENE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO4
Molecular weight293.36 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid
InChIKeyMYWZFJXOLAXENE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCC1=CC=CC=C1)CC(=O)O

Computed by PubChem (NCBI)