CAS 849440-31-9 appears in our catalog under these names: Boc-l-2,4-dimethylphenylalanine, 95%, Boc–L–2,4–dimethylphenylalanine, Boc-L-2,4-dimethylphenylalanine, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S)-3-(2,4-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 849440-31-9) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-3-(2,4-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AVJPLTQARRYWFZ-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-3-(2,4-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AVJPLTQARRYWFZ-ZDUSSCGKSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)