CAS 95576-84-4 appears in our catalog under these names: N2-Methyl-4-nitro-1,2-benzenediamine, 95%, N1-Methyl-5-nitrobenzene-1,2-diamine, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-N-methyl-4-nitrobenzene-1,2-diamine (CAS 95576-84-4) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: 2-N-methyl-4-nitrobenzene-1,2-diamine. InChIKey: NVNGTTDFLMOBMZ-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 2-N-methyl-4-nitrobenzene-1,2-diamine |
| InChIKey | NVNGTTDFLMOBMZ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)