Products 95580-90-8
CAS 95580-90-8 is the registry number for 2,3,4-Tri-O-acetyl-a-L-rhamnopyranosyl azide. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
[(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate (CAS 95580-90-8) is a chemical compound with the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. IUPAC name: [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate. InChIKey: MKZJGETUNXHZRX-YTYCZEAOSA-N.
| Molecular formula | C12H17N3O7 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate |
| InChIKey | MKZJGETUNXHZRX-YTYCZEAOSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)