CAS 95581-07-0 is the registry number for 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 250mg, 1g, 2g, 1000mg.
[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate (CAS 95581-07-0) is a chemical compound with the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. IUPAC name: [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate. InChIKey: MKZJGETUNXHZRX-MOBXTKCLSA-N.
| Molecular formula | C12H17N3O7 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate |
| InChIKey | MKZJGETUNXHZRX-MOBXTKCLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)