Products 95581-07-0

CAS 95581-07-0 is the registry number for 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 250mg, 1g, 2g, 1000mg.

Structural formula: {0} (CAS {1})

[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate (CAS 95581-07-0) is a chemical compound with the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. IUPAC name: [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate. InChIKey: MKZJGETUNXHZRX-MOBXTKCLSA-N.

Identity
Molecular formulaC12H17N3O7
Molecular weight315.28 g/mol
IUPAC name[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate
InChIKeyMKZJGETUNXHZRX-MOBXTKCLSA-N
SMILESC[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)