Products 115435-17-1
CAS 115435-17-1 is the registry number for 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
[(2S,3R,4S,5S,6S)-4,6-diacetyloxy-5-azido-2-methyloxan-3-yl] acetate (CAS 115435-17-1) is a chemical compound with the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. IUPAC name: [(2S,3R,4S,5S,6S)-4,6-diacetyloxy-5-azido-2-methyloxan-3-yl] acetate. InChIKey: JBUGOMFHZVGOMN-WWSHQCSISA-N.
| Molecular formula | C12H17N3O7 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6S)-4,6-diacetyloxy-5-azido-2-methyloxan-3-yl] acetate |
| InChIKey | JBUGOMFHZVGOMN-WWSHQCSISA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC(=O)C)N=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)