CAS 95720-01-7 is the registry number for 9(R)–δ6a,10a–THC. Offered by: GLPBio. Available pack sizes: 1mg.
(9R)-6,6,9-trimethyl-3-pentyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol (CAS 95720-01-7) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (9R)-6,6,9-trimethyl-3-pentyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol. InChIKey: NEBZNJDFIPBXCS-CQSZACIVSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (9R)-6,6,9-trimethyl-3-pentyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | NEBZNJDFIPBXCS-CQSZACIVSA-N |
| SMILES | CCCCCC1=CC(=C2C3=C(CC[C@H](C3)C)C(OC2=C1)(C)C)O |
Computed by PubChem (NCBI)