CAS 957872-91-2 appears in our catalog under these names: 3-Benzyloxathiazolidine 2,2-dioxide, 95%, 3-Benzyloxathiazolidine 2,2-dioxide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
3-benzyloxathiazolidine 2,2-dioxide (CAS 957872-91-2) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 3-benzyloxathiazolidine 2,2-dioxide. InChIKey: LXNUUWWYTMUXBY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 3-benzyloxathiazolidine 2,2-dioxide |
| InChIKey | LXNUUWWYTMUXBY-UHFFFAOYSA-N |
| SMILES | C1COS(=O)(=O)N1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)