Products 958266-29-0

CAS 958266-29-0 is the registry number for Methyl 4-chloro-5-hydroxy-3-pyridinecarboxylate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-chloro-5-hydroxypyridine-3-carboxylate (CAS 958266-29-0) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 4-chloro-5-hydroxypyridine-3-carboxylate. InChIKey: NVMFTKNGJXEGDX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO3
Molecular weight187.58 g/mol
IUPAC namemethyl 4-chloro-5-hydroxypyridine-3-carboxylate
InChIKeyNVMFTKNGJXEGDX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=CC(=C1Cl)O

Computed by PubChem (NCBI)