Products 95853-32-0
CAS 95853-32-0 is the registry number for Methyl 2-(adamantan-1-yl)-2-aminoacetate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(1-adamantyl)-2-aminoacetate;hydrochloride (CAS 95853-32-0) is a chemical compound with the molecular formula C13H22ClNO2 and a molecular weight of 259.77 g/mol. IUPAC name: methyl 2-(1-adamantyl)-2-aminoacetate;hydrochloride. InChIKey: WJNNVAVZDVJLOW-UHFFFAOYSA-N.
| Molecular formula | C13H22ClNO2 |
|---|---|
| Molecular weight | 259.77 g/mol |
| IUPAC name | methyl 2-(1-adamantyl)-2-aminoacetate;hydrochloride |
| InChIKey | WJNNVAVZDVJLOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C12CC3CC(C1)CC(C3)C2)N.Cl |
Computed by PubChem (NCBI)