CAS 958649-20-2 is the registry number for Trans-2-(3-bromophenyl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-(3-bromophenyl)cyclopropan-1-amine (CAS 958649-20-2) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: trans-(1R,2S)-2-(3-bromophenyl)cyclopropan-1-amine. InChIKey: CFVKOAMEQVZCAM-DTWKUNHWSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-bromophenyl)cyclopropan-1-amine |
| InChIKey | CFVKOAMEQVZCAM-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)