CAS 959396-05-5 is the registry number for 3-Hydroxy-17-oxo-estra-1,3,5(10)-triene-4-carboxylic Acid. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
[(E)-1-(3-methoxyphenyl)ethylideneamino]urea (CAS 959396-05-5) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: [(E)-1-(3-methoxyphenyl)ethylideneamino]urea. InChIKey: BMZNDZUKBXFFPO-KPKJPENVSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | [(E)-1-(3-methoxyphenyl)ethylideneamino]urea |
| InChIKey | BMZNDZUKBXFFPO-KPKJPENVSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)