CAS 959617-87-9 is the registry number for (3R,4R)-Benzyl 4-amino-3-hydroxypiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
Benzyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 959617-87-9) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: benzyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: IRKGMFWANMCSOS-VXGBXAGGSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | benzyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | IRKGMFWANMCSOS-VXGBXAGGSA-N |
| SMILES | C1CN(C[C@H]([C@@H]1N)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)