Products 75801-52-4

CAS 75801-52-4 is the registry number for N,N-Dimethyl Z-DL-Alaninamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate (CAS 75801-52-4) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: benzyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate. InChIKey: FABGDABUBWEOOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O3
Molecular weight250.29 g/mol
IUPAC namebenzyl N-[1-(dimethylamino)-1-oxopropan-2-yl]carbamate
InChIKeyFABGDABUBWEOOQ-UHFFFAOYSA-N
SMILESCC(C(=O)N(C)C)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)