Products 960049-21-2
CAS 960049-21-2 appears in our catalog under these names: N-Nitrosopiperidine-d10, N-Nitrosopiperidine-d10, >95% (HPLC), N-Nitrosopiperidine D10, N-Nitrosopiperidine-d10, 98 atom % D, min 98% Chemical Purity, N–Nitrosopiperidine–d10. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 0,1g, 0,05g, 2500μg, 100mg.
2,2,3,3,4,4,5,5,6,6-decadeuterio-1-nitrosopiperidine (CAS 960049-21-2) is a chemical compound with the molecular formula C5H10N2O and a molecular weight of 124.21 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-nitrosopiperidine. InChIKey: UWSDONTXWQOZFN-YXALHFAPSA-N.
| Molecular formula | C5H10N2O |
|---|---|
| Molecular weight | 124.21 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-nitrosopiperidine |
| InChIKey | UWSDONTXWQOZFN-YXALHFAPSA-N |
| SMILES | [2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])N=O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)