CAS 99389-11-4 appears in our catalog under these names: N-Nitrosopiperidine-d4, >95% (HPLC), 1-Nitrosopiperidine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10 mg, 1 mg, 5 mg.
2,2,6,6-tetradeuterio-1-nitrosopiperidine (CAS 99389-11-4) is a chemical compound with the molecular formula C5H10N2O and a molecular weight of 118.17 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-1-nitrosopiperidine. InChIKey: UWSDONTXWQOZFN-CQOLUAMGSA-N.
| Molecular formula | C5H10N2O |
|---|---|
| Molecular weight | 118.17 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-1-nitrosopiperidine |
| InChIKey | UWSDONTXWQOZFN-CQOLUAMGSA-N |
| SMILES | [2H]C1(CCCC(N1N=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)