CAS 960050-59-3 is the registry number for (8α,9S)–9–Aminocinchonan–6'–ol. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
4-[(S)-amino-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol (CAS 960050-59-3) is a chemical compound with the molecular formula C19H23N3O and a molecular weight of 309.4 g/mol. IUPAC name: 4-[(S)-amino-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol. InChIKey: BVEMLWTWKOYCIY-OYUDYFSCSA-N.
| Molecular formula | C19H23N3O |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-[(S)-amino-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol |
| InChIKey | BVEMLWTWKOYCIY-OYUDYFSCSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)O)N |
Computed by PubChem (NCBI)