CAS 96013-77-3 is the registry number for {3-((tert-Butyldimethylsilyl)oxy)phenyl}methanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol (CAS 96013-77-3) is a chemical compound with the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol. InChIKey: SIGXMQNKJVKPQJ-UHFFFAOYSA-N.
| Molecular formula | C13H22O2Si |
|---|---|
| Molecular weight | 238.40 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxyphenyl]methanol |
| InChIKey | SIGXMQNKJVKPQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=CC(=C1)CO |
Computed by PubChem (NCBI)