CAS 96013-80-8 appears in our catalog under these names: 2-(((tert-Butyldimethylsilyl)oxy)methyl)phenol, 98%, 2-(tert-Butyldimethylsiloxymethyl)phenol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol (CAS 96013-80-8) is a chemical compound with the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. IUPAC name: 2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol. InChIKey: JSNNPYJILIFBES-UHFFFAOYSA-N.
| Molecular formula | C13H22O2Si |
|---|---|
| Molecular weight | 238.40 g/mol |
| IUPAC name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol |
| InChIKey | JSNNPYJILIFBES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC=CC=C1O |
Computed by PubChem (NCBI)