CAS 96512-76-4 appears in our catalog under these names: Chlortalidone Impurity 9, O-Methyl Chlorthalidone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
2-chloro-5-(1-methoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide (CAS 96512-76-4) is a chemical compound with the molecular formula C15H13ClN2O4S and a molecular weight of 352.8 g/mol. IUPAC name: 2-chloro-5-(1-methoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide. InChIKey: OBWXDZPCMDDANS-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O4S |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 2-chloro-5-(1-methoxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide |
| InChIKey | OBWXDZPCMDDANS-UHFFFAOYSA-N |
| SMILES | COC1(C2=CC=CC=C2C(=O)N1)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)