CAS 676995-91-8 appears in our catalog under these names: 4-((2-Carbamoyl-5-(4-chlorophenyl)thiophen-3-yl)amino)-4-oxobutanoic acid, 97%, FtsZ-IN-10. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, Get quote.
4-[[2-carbamoyl-5-(4-chlorophenyl)thiophen-3-yl]amino]-4-oxobutanoic acid (CAS 676995-91-8) is a chemical compound with the molecular formula C15H13ClN2O4S and a molecular weight of 352.8 g/mol. IUPAC name: 4-[[2-carbamoyl-5-(4-chlorophenyl)thiophen-3-yl]amino]-4-oxobutanoic acid. InChIKey: AKEGBXSYBBSAOX-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O4S |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 4-[[2-carbamoyl-5-(4-chlorophenyl)thiophen-3-yl]amino]-4-oxobutanoic acid |
| InChIKey | AKEGBXSYBBSAOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(S2)C(=O)N)NC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)