CAS 96739-36-5 appears in our catalog under these names: 2-(Methoxy-d3)benzoic acid, 95%, Salicylic Acid Methyl Ether-d3, >95% (HPLC), 2-Methoxybenzoic acid-d3. Offered by: Combi-blocks, TRC, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 25mg, 5 mg, 50 mg, 100 mg, 10 mg.
2-(trideuteriomethoxy)benzoic acid (CAS 96739-36-5) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 2-(trideuteriomethoxy)benzoic acid. InChIKey: ILUJQPXNXACGAN-FIBGUPNXSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 2-(trideuteriomethoxy)benzoic acid |
| InChIKey | ILUJQPXNXACGAN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)