Products 96905-49-6

CAS 96905-49-6 is the registry number for 2-Oxoazepane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-oxoazepane-3-carboxylic acid (CAS 96905-49-6) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: 2-oxoazepane-3-carboxylic acid. InChIKey: MQXIMPGNIJCBHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO3
Molecular weight157.17 g/mol
IUPAC name2-oxoazepane-3-carboxylic acid
InChIKeyMQXIMPGNIJCBHZ-UHFFFAOYSA-N
SMILESC1CCNC(=O)C(C1)C(=O)O

Computed by PubChem (NCBI)