Products 97095-89-1

CAS 97095-89-1 is the registry number for 1-Benzhydryl-4-benzylpiperazine. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-benzhydryl-4-benzylpiperazine (CAS 97095-89-1) is a chemical compound with the molecular formula C24H26N2 and a molecular weight of 342.5 g/mol. IUPAC name: 1-benzhydryl-4-benzylpiperazine. InChIKey: KUAJKNGLESWEFE-UHFFFAOYSA-N.

Identity
Molecular formulaC24H26N2
Molecular weight342.5 g/mol
IUPAC name1-benzhydryl-4-benzylpiperazine
InChIKeyKUAJKNGLESWEFE-UHFFFAOYSA-N
SMILESC1CN(CCN1CC2=CC=CC=C2)C(C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)