CAS 97166-79-5 appears in our catalog under these names: 2-(4-Chlorophenyl)-2,3-dihydro-1H-isoindol-1-imine, 95%, 2-(4-Chlorophenyl)-2,3-dihydro-1H-isoindol-1-imine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(4-chlorophenyl)-3H-isoindol-1-imine (CAS 97166-79-5) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-3H-isoindol-1-imine. InChIKey: PWKIUOZRZMHOTH-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3H-isoindol-1-imine |
| InChIKey | PWKIUOZRZMHOTH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=N)N1C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)