CAS 97277-15-1 is the registry number for (1S,3R,5S)-rel-2-Azabicyclo[3.1.0]hexane-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS 97277-15-1) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid. InChIKey: XBEMWFUKTKDJKP-VAYJURFESA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| InChIKey | XBEMWFUKTKDJKP-VAYJURFESA-N |
| SMILES | C1[C@@H]2[C@H]1N[C@H](C2)C(=O)O |
Computed by PubChem (NCBI)