CAS 97626-98-7 is the registry number for 2-Methyl-n-(2-oxo-1,2-dihydropyrimidin-4-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-methyl-N-(2-oxo-1H-pyrimidin-6-yl)propanamide (CAS 97626-98-7) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 2-methyl-N-(2-oxo-1H-pyrimidin-6-yl)propanamide. InChIKey: FLVJQSFUDPURFP-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-methyl-N-(2-oxo-1H-pyrimidin-6-yl)propanamide |
| InChIKey | FLVJQSFUDPURFP-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC=NC(=O)N1 |
Computed by PubChem (NCBI)