Products 97760-89-9
CAS 97760-89-9 is the registry number for 1-(4-AMINO-3-FLUOROPHENYL)-2-BROMOETHANONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-amino-3-fluorophenyl)-2-bromoethanone (CAS 97760-89-9) is a chemical compound with the molecular formula C8H7BrFNO and a molecular weight of 232.05 g/mol. IUPAC name: 1-(4-amino-3-fluorophenyl)-2-bromoethanone. InChIKey: LOANHALOZSNPOE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | 1-(4-amino-3-fluorophenyl)-2-bromoethanone |
| InChIKey | LOANHALOZSNPOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)F)N |
Computed by PubChem (NCBI)