CAS 97975-66-1 appears in our catalog under these names: (R)-4-Amino-5-ethoxy-5-oxopentanoic acid, 97%, H–D–Glu–Oet. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100g, 25g.
(4R)-4-amino-5-ethoxy-5-oxopentanoic acid (CAS 97975-66-1) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (4R)-4-amino-5-ethoxy-5-oxopentanoic acid. InChIKey: SYQNQPHXKWWZFS-RXMQYKEDSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (4R)-4-amino-5-ethoxy-5-oxopentanoic acid |
| InChIKey | SYQNQPHXKWWZFS-RXMQYKEDSA-N |
| SMILES | CCOC(=O)[C@@H](CCC(=O)O)N |
Computed by PubChem (NCBI)