cas: 550998-61-3 — see every product listed under this CAS number, including other names
7-Bromo-5-fluorobenzofuran-2-carboxylic acid, 98% (CAS 550998-61-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F774534-1G |
| cas | 550998-61-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 924.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
7-bromo-5-fluoro-1-benzofuran-2-carboxylic acid (CAS 550998-61-3) is a chemical compound with the molecular formula C9H4BrFO3 and a molecular weight of 259.03 g/mol. IUPAC name: 7-bromo-5-fluoro-1-benzofuran-2-carboxylic acid. InChIKey: IZWDHPQCEFISNF-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO3 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 7-bromo-5-fluoro-1-benzofuran-2-carboxylic acid |
| InChIKey | IZWDHPQCEFISNF-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(OC2=C(C=C1F)Br)C(=O)O |
Computed by PubChem (NCBI)