CAS 98141-54-9 is the registry number for 4-Amino-3,5-dichlorobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-3,5-dichlorobenzenesulfonyl chloride (CAS 98141-54-9) is a chemical compound with the molecular formula C6H4Cl3NO2S and a molecular weight of 260.5 g/mol. IUPAC name: 4-amino-3,5-dichlorobenzenesulfonyl chloride. InChIKey: GMQGRTBKYOJTMW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO2S |
|---|---|
| Molecular weight | 260.5 g/mol |
| IUPAC name | 4-amino-3,5-dichlorobenzenesulfonyl chloride |
| InChIKey | GMQGRTBKYOJTMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)