CAS 98266-32-1 appears in our catalog under these names: Boc–D–2–Pal–OH, (R)-2-tert-Butoxycarbonylamino-3-(pyridin-2-yl)propionic acid, 97%, 97%, Boc-D-2-Pal-OH, 99.91%, Boc-D-2-Pyridylalanine, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 5 g, 25 g, 10 g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoic acid (CAS 98266-32-1) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoic acid. InChIKey: KMODKKCXWFNEIK-SNVBAGLBSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoic acid |
| InChIKey | KMODKKCXWFNEIK-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=N1)C(=O)O |
Computed by PubChem (NCBI)