CAS 98434-22-1 appears in our catalog under these names: 6-Bromo-2H-benzo(b)(1,4)thiazin-3(4H)-one, 98%, 2H-1,4-Benzothiazin-3(4H)-one, 6-bromo-, 98%, 98%, 6-BROMO-2H-BENZO[B][1,4]THIAZIN-3(4H)-ONE, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
6-bromo-4H-1,4-benzothiazin-3-one (CAS 98434-22-1) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: 6-bromo-4H-1,4-benzothiazin-3-one. InChIKey: QXMFOFHASVVZIT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 6-bromo-4H-1,4-benzothiazin-3-one |
| InChIKey | QXMFOFHASVVZIT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)