Products 98619-26-2
CAS 98619-26-2 appears in our catalog under these names: Arisantetralone D, Epischisandrone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg, Get quote.
(2R,3S,4R)-4-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2,3-dimethyl-3,4-dihydro-2H-naphthalen-1-one (CAS 98619-26-2) is a chemical compound with the molecular formula C21H24O5 and a molecular weight of 356.4 g/mol. IUPAC name: (2R,3S,4R)-4-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2,3-dimethyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: DRKPZVVNEGETTG-FKANQGBASA-N.
| Molecular formula | C21H24O5 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2R,3S,4R)-4-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2,3-dimethyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | DRKPZVVNEGETTG-FKANQGBASA-N |
| SMILES | C[C@@H]1[C@H](C(=O)C2=CC(=C(C=C2[C@H]1C3=CC(=C(C=C3)OC)OC)OC)O)C |
Computed by PubChem (NCBI)