Products 98626-60-9

CAS 98626-60-9 is the registry number for Ropivacaine Impurity 14. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R)-N-(2,6-dimethylphenyl)-1-ethylpiperidine-2-carboxamide (CAS 98626-60-9) is a chemical compound with the molecular formula C16H24N2O and a molecular weight of 260.37 g/mol. IUPAC name: (2R)-N-(2,6-dimethylphenyl)-1-ethylpiperidine-2-carboxamide. InChIKey: AALBZAYEBOEAPQ-CQSZACIVSA-N.

Identity
Molecular formulaC16H24N2O
Molecular weight260.37 g/mol
IUPAC name(2R)-N-(2,6-dimethylphenyl)-1-ethylpiperidine-2-carboxamide
InChIKeyAALBZAYEBOEAPQ-CQSZACIVSA-N
SMILESCCN1CCCC[C@@H]1C(=O)NC2=C(C=CC=C2C)C

Computed by PubChem (NCBI)